Compound Q&A

How is 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) typically synthesized?

Answer

5-Bromo-2-chlorobenzoyl chloride
5-Bromo-2-chlorobenzoyl chloride is typically synthesized via a multi-step process involving the bromination and chlorination of benzene, followed by acylation. This process often requires the use of a phase transfer catalyst and generates high yields. The exact method can vary, but common solvents like dichloromethane are used, and the product is isolated by recrystallization.

About

CAS No 21900-52-7
English Name 5-Bromo-2-chlorobenzoyl chloride
Molecular Formula C7H3BrCl2O
Molecular Weight 253.91 g/mol
SMILES C1=CC(=C(C=C1Br)C(=O)Cl)Cl
InChIKey TZIQQJRRMJWMDI-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) finds application in the pharmaceutical, polymer,...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

When handling 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7), it is essential to use personal pr...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...