Compound Q&A

How is 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) typically synthesized?

Answer

5-Bromo-2-chlorobenzoyl chloride
5-Bromo-2-chlorobenzoyl chloride is typically synthesized via a multi-step process involving the bromination and chlorination of benzene, followed by acylation. This process often requires the use of a phase transfer catalyst and generates high yields. The exact method can vary, but common solvents like dichloromethane are used, and the product is isolated by recrystallization.

About

CAS No 21900-52-7
English Name 5-Bromo-2-chlorobenzoyl chloride
Molecular Formula C7H3BrCl2O
Molecular Weight 253.91 g/mol
SMILES C1=CC(=C(C=C1Br)C(=O)Cl)Cl
InChIKey TZIQQJRRMJWMDI-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) finds application in the pharmaceutical, polymer,...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

When handling 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7), it is essential to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...