Compound Q&A

What precautions should be taken when handling 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

Answer

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine
Precautions when handling 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine include the use of personal protective equipment such as gloves, goggles, and lab coats. It should be stored in a well-ventilated area away from direct sunlight and heat. Spills should be handled with caution using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

English Name 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine
Molecular Formula C14H17IN4O2
Molecular Weight 400.22 g/mol
SMILES CC(C)c1cc(c(cc1Oc2cnc(nc2N)N)I)OC
InChIKey AATPYXMXFBBKFO-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is a crystalline compound with a molec...

Compound Q&A

How is 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2) typically synthesized?

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is typically synthesized through a mul...

Compound Q&A

What industries use 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is primarily used in the pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...