Compound Q&A

How is 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2) typically synthesized?

Answer

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine
5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is typically synthesized through a multi-step process involving the protection of the methoxy group, introduction of the isopropyl group, followed by iodination and the final pyrimidine coupling. This synthesis often requires the use of reagents like N,N-dimethylformamide (DMF), sodium iodide, and a palladium catalyst. The yield is moderate, around 50-70%, and the selectivity is high.

About

English Name 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine
Molecular Formula C14H17IN4O2
Molecular Weight 400.22 g/mol
SMILES CC(C)c1cc(c(cc1Oc2cnc(nc2N)N)I)OC
InChIKey AATPYXMXFBBKFO-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is a crystalline compound with a molec...

Compound Q&A

What industries use 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

Precautions when handling 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine include the ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...