Compound Q&A

What industries use 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

Answer

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine
5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is primarily used in the pharmaceutical industry for the development of novel drugs. It also finds applications in the synthesis of organic semiconductors and in the development of advanced materials for sensors and polymers. Its unique structure makes it valuable in these fields.

About

English Name 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine
Molecular Formula C14H17IN4O2
Molecular Weight 400.22 g/mol
SMILES CC(C)c1cc(c(cc1Oc2cnc(nc2N)N)I)OC
InChIKey AATPYXMXFBBKFO-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is a crystalline compound with a molec...

Compound Q&A

How is 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2) typically synthesized?

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is typically synthesized through a mul...

Compound Q&A

What precautions should be taken when handling 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

Precautions when handling 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine include the ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...