Compound Q&A

What are the physical and chemical properties of 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

Answer

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine
5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is a crystalline compound with a molecular weight of approximately 451.26 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and acetone. This compound is reactive towards nucleophiles and electrophiles. It can undergo nucleophilic substitution reactions and can be used in the synthesis of other compounds.

About

English Name 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine
Molecular Formula C14H17IN4O2
Molecular Weight 400.22 g/mol
SMILES CC(C)c1cc(c(cc1Oc2cnc(nc2N)N)I)OC
InChIKey AATPYXMXFBBKFO-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2) typically synthesized?

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is typically synthesized through a mul...

Compound Q&A

What industries use 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine (CAS: 865305-30-2)?

Precautions when handling 5-(5-Iodo-2-isopropyl-4-methoxyphenoxy)-2,4-pyrimidinediamine include the ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...