Compound Q&A

What precautions should be taken when handling 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

Answer

3-(2,4-Dihydroxyphenyl)acrylic acid
When handling 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8), it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be handled with caution using absorbent materials and the appropriate safety measures. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 614-86-8
English Name 3-(2,4-Dihydroxyphenyl)acrylic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1=CC(=C(C=C1O)O)C=CC(=O)O
InChIKey HGEFWFBFQKWVMY-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) is a white to off-white crystalline solid with a...

Compound Q&A

How is 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) typically synthesized?

3-(2,4-Dihydroxyphenyl)acrylic acid is typically synthesized via the condensation of 2,4-dihydroxybe...

Compound Q&A

What industries use 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) finds applications in various industries, includ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...