Compound Q&A

What industries use 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

Answer

3-(2,4-Dihydroxyphenyl)acrylic acid
3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) finds applications in various industries, including pharmaceuticals, where it serves as a key intermediate for the synthesis of certain drugs. It is also used in the production of polymers, specifically in the development of biodegradable materials and in the manufacturing of photolithographic resists for semiconductor fabrication.

About

CAS No 614-86-8
English Name 3-(2,4-Dihydroxyphenyl)acrylic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1=CC(=C(C=C1O)O)C=CC(=O)O
InChIKey HGEFWFBFQKWVMY-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) is a white to off-white crystalline solid with a...

Compound Q&A

How is 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) typically synthesized?

3-(2,4-Dihydroxyphenyl)acrylic acid is typically synthesized via the condensation of 2,4-dihydroxybe...

Compound Q&A

What precautions should be taken when handling 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

When handling 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...