Compound Q&A

What are the physical and chemical properties of 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

Answer

3-(2,4-Dihydroxyphenyl)acrylic acid
3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) is a white to off-white crystalline solid with a molecular weight of approximately 190.15 g/mol. It is slightly soluble in water and readily soluble in organic solvents like ethanol and acetone. The compound is reactive, especially towards nucleophiles and reducing agents, making it useful in various synthetic applications.

About

CAS No 614-86-8
English Name 3-(2,4-Dihydroxyphenyl)acrylic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1=CC(=C(C=C1O)O)C=CC(=O)O
InChIKey HGEFWFBFQKWVMY-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) typically synthesized?

3-(2,4-Dihydroxyphenyl)acrylic acid is typically synthesized via the condensation of 2,4-dihydroxybe...

Compound Q&A

What industries use 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) finds applications in various industries, includ...

Compound Q&A

What precautions should be taken when handling 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

When handling 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...