Compound Q&A

How is 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) typically synthesized?

Answer

3-(2,4-Dihydroxyphenyl)acrylic acid
3-(2,4-Dihydroxyphenyl)acrylic acid is typically synthesized via the condensation of 2,4-dihydroxybenzaldehyde with acryloyl chloride. The reaction proceeds under mild conditions, often using a catalytic amount of a Lewis acid like zinc chloride to improve yield and selectivity. The final product is isolated by crystallization and recrystallization to obtain the desired purity.

About

CAS No 614-86-8
English Name 3-(2,4-Dihydroxyphenyl)acrylic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1=CC(=C(C=C1O)O)C=CC(=O)O
InChIKey HGEFWFBFQKWVMY-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) is a white to off-white crystalline solid with a...

Compound Q&A

What industries use 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8) finds applications in various industries, includ...

Compound Q&A

What precautions should be taken when handling 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8)?

When handling 3-(2,4-Dihydroxyphenyl)acrylic acid (CAS: 614-86-8), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...