Compound Q&A

What precautions should be taken when handling 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3)?

Answer

3-Chloro-2-methoxypyridine-5-boronic acid
When handling 3-Chloro-2-methoxypyridine-5-boronic acid, it is important to use appropriate personal protective equipment (PPE) such as gloves and safety goggles. Handle in a fume hood to avoid inhalation of vapors. In case of spill, use suitable absorbent materials and dispose of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

English Name 3-Chloro-2-methoxypyridine-5-boronic acid
Molecular Formula C6H7BClNO3
Molecular Weight 187.39 g/mol
SMILES B(C1=CC(=C(N=C1)OC)Cl)(O)O
InChIKey LOLPLMDQLOJSDH-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3)?

3-Chloro-2-methoxypyridine-5-boronic acid has a crystalline form with a molecular weight of approxim...

Compound Q&A

How is 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3) typically synthesized?

3-Chloro-2-methoxypyridine-5-boronic acid is typically synthesized through the boronation of 3-chlor...

Compound Q&A

What industries use 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3)?

3-Chloro-2-methoxypyridine-5-boronic acid is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...