Compound Q&A

How is 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3) typically synthesized?

Answer

3-Chloro-2-methoxypyridine-5-boronic acid
3-Chloro-2-methoxypyridine-5-boronic acid is typically synthesized through the boronation of 3-chloro-2-methoxypyridine using pinacol borane (H3P(OC(CH3)2)2) as the boronating agent. This reaction proceeds with high selectivity and good yield under mild conditions, often requiring a Lewis acid catalyst such as copper(II) acetate to enhance reactivity.

About

English Name 3-Chloro-2-methoxypyridine-5-boronic acid
Molecular Formula C6H7BClNO3
Molecular Weight 187.39 g/mol
SMILES B(C1=CC(=C(N=C1)OC)Cl)(O)O
InChIKey LOLPLMDQLOJSDH-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3)?

3-Chloro-2-methoxypyridine-5-boronic acid has a crystalline form with a molecular weight of approxim...

Compound Q&A

What industries use 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3)?

3-Chloro-2-methoxypyridine-5-boronic acid is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3)?

When handling 3-Chloro-2-methoxypyridine-5-boronic acid, it is important to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...