Compound Q&A

What industries use 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3)?

Answer

3-Chloro-2-methoxypyridine-5-boronic acid
3-Chloro-2-methoxypyridine-5-boronic acid is used in the pharmaceutical industry for the synthesis of various drug molecules. It is also utilized in the polymer industry as an additive for enhancing material properties and in the semiconductor industry for the fabrication of electronic devices due to its boron-containing functionality.

About

English Name 3-Chloro-2-methoxypyridine-5-boronic acid
Molecular Formula C6H7BClNO3
Molecular Weight 187.39 g/mol
SMILES B(C1=CC(=C(N=C1)OC)Cl)(O)O
InChIKey LOLPLMDQLOJSDH-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3)?

3-Chloro-2-methoxypyridine-5-boronic acid has a crystalline form with a molecular weight of approxim...

Compound Q&A

How is 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3) typically synthesized?

3-Chloro-2-methoxypyridine-5-boronic acid is typically synthesized through the boronation of 3-chlor...

Compound Q&A

What precautions should be taken when handling 3-Chloro-2-methoxypyridine-5-boronic acid (CAS: 942438-89-3)?

When handling 3-Chloro-2-methoxypyridine-5-boronic acid, it is important to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...