Compound Q&A

What industries use 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2)?

Answer

4-Cyclopropoxyphenylboronic acid
4-Cyclopropoxyphenylboronic acid is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry as a precursor for the production of various polymers and in the sensor industry for the fabrication of chemical and biological sensors. Additionally, it is used in the semiconductor industry for the production of specific materials.

About

English Name 4-Cyclopropoxyphenylboronic acid
Molecular Formula C9H11BO3
Molecular Weight 178 g/mol
SMILES B(C1=CC=C(C=C1)OC2CC2)(O)O
InChIKey IZOOGQYKHWNGOK-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2)?

4-Cyclopropoxyphenylboronic acid is a white or off-white crystalline solid with a molecular weight o...

Compound Q&A

How is 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2) typically synthesized?

4-Cyclopropoxyphenylboronic acid can be synthesized via the boronation of 4-hydroxybenzaldehyde with...

Compound Q&A

What precautions should be taken when handling 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2)?

When handling 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2), appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...