Compound Q&A

What are the physical and chemical properties of 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2)?

Answer

4-Cyclopropoxyphenylboronic acid
4-Cyclopropoxyphenylboronic acid is a white or off-white crystalline solid with a molecular weight of approximately 262.3 g/mol. It has good solubility in organic solvents like dichloromethane and poor solubility in water. The compound exhibits electrophilic reactivity towards nucleophiles and can undergo various reactions such as coupling reactions. It is stable under normal conditions but should be stored away from moisture and strong acids.

About

English Name 4-Cyclopropoxyphenylboronic acid
Molecular Formula C9H11BO3
Molecular Weight 178 g/mol
SMILES B(C1=CC=C(C=C1)OC2CC2)(O)O
InChIKey IZOOGQYKHWNGOK-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2) typically synthesized?

4-Cyclopropoxyphenylboronic acid can be synthesized via the boronation of 4-hydroxybenzaldehyde with...

Compound Q&A

What industries use 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2)?

4-Cyclopropoxyphenylboronic acid is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2)?

When handling 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2), appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...