Compound Q&A

How is 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2) typically synthesized?

Answer

4-Cyclopropoxyphenylboronic acid
4-Cyclopropoxyphenylboronic acid can be synthesized via the boronation of 4-hydroxybenzaldehyde with cyclopropanol in the presence of a boronic acid catalyst, such as tetrakis(triphenylphosphine)palladium(0), in the presence of a base like triethylamine. The reaction typically yields a product with a high degree of purity and selectivity, with a yield of around 70-80%.

About

English Name 4-Cyclopropoxyphenylboronic acid
Molecular Formula C9H11BO3
Molecular Weight 178 g/mol
SMILES B(C1=CC=C(C=C1)OC2CC2)(O)O
InChIKey IZOOGQYKHWNGOK-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2)?

4-Cyclopropoxyphenylboronic acid is a white or off-white crystalline solid with a molecular weight o...

Compound Q&A

What industries use 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2)?

4-Cyclopropoxyphenylboronic acid is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2)?

When handling 4-Cyclopropoxyphenylboronic acid (CAS: 871829-90-2), appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...