Compound Q&A

What precautions should be taken when handling (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

Answer

(6-Bromo-2,3-difluorophenyl)boronic acid
When handling (6-Bromo-2,3-difluorophenyl)boronic acid, it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbents, and the area should be well-ventilated. For detailed safety information, refer to the Material Safety Data Sheet (MSDS) or Safety Data Sheet (SDS). The compound is not considered highly toxic, but it should still be handled with care due to its reactivity and potential skin irritation.

About

English Name (6-Bromo-2,3-difluorophenyl)boronic acid
Molecular Formula C6H4BBrF2O2
Molecular Weight 236.81 g/mol
SMILES FC1=C(F)C(B(O)O)=C(Br)C=C1
InChIKey VZVDYVBOSRNBQL-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

(6-Bromo-2,3-difluorophenyl)boronic acid is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8) typically synthesized?

(6-Bromo-2,3-difluorophenyl)boronic acid can be synthesized by the Finkelstein method, where 2,3-dif...

Compound Q&A

What industries use (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

(6-Bromo-2,3-difluorophenyl)boronic acid is primarily used in pharmaceuticals and polymer synthesis....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...