Compound Q&A

What are the physical and chemical properties of (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

Answer

(6-Bromo-2,3-difluorophenyl)boronic acid
(6-Bromo-2,3-difluorophenyl)boronic acid is a crystalline compound with a molecular weight of approximately 312.02 g/mol. It is slightly soluble in water but has good solubility in organic solvents like ethanol and acetonitrile. This compound exhibits moderate reactivity, particularly towards esters and carboxylic acids, making it useful in various organic synthesis reactions. Its physical properties include a melting point around 160-165°C and a density of approximately 1.35 g/cm³.

About

English Name (6-Bromo-2,3-difluorophenyl)boronic acid
Molecular Formula C6H4BBrF2O2
Molecular Weight 236.81 g/mol
SMILES FC1=C(F)C(B(O)O)=C(Br)C=C1
InChIKey VZVDYVBOSRNBQL-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8) typically synthesized?

(6-Bromo-2,3-difluorophenyl)boronic acid can be synthesized by the Finkelstein method, where 2,3-dif...

Compound Q&A

What industries use (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

(6-Bromo-2,3-difluorophenyl)boronic acid is primarily used in pharmaceuticals and polymer synthesis....

Compound Q&A

What precautions should be taken when handling (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

When handling (6-Bromo-2,3-difluorophenyl)boronic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...