Compound Q&A

What industries use (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

Answer

(6-Bromo-2,3-difluorophenyl)boronic acid
(6-Bromo-2,3-difluorophenyl)boronic acid is primarily used in pharmaceuticals and polymer synthesis. It serves as a key intermediate in the synthesis of drug molecules, particularly those targeting specific receptors. Additionally, it finds applications in the development of advanced materials and sensors, where its unique chemical functionalities are utilized to enhance performance and stability.

About

English Name (6-Bromo-2,3-difluorophenyl)boronic acid
Molecular Formula C6H4BBrF2O2
Molecular Weight 236.81 g/mol
SMILES FC1=C(F)C(B(O)O)=C(Br)C=C1
InChIKey VZVDYVBOSRNBQL-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

(6-Bromo-2,3-difluorophenyl)boronic acid is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8) typically synthesized?

(6-Bromo-2,3-difluorophenyl)boronic acid can be synthesized by the Finkelstein method, where 2,3-dif...

Compound Q&A

What precautions should be taken when handling (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

When handling (6-Bromo-2,3-difluorophenyl)boronic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...