Compound Q&A

How is (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8) typically synthesized?

Answer

(6-Bromo-2,3-difluorophenyl)boronic acid
(6-Bromo-2,3-difluorophenyl)boronic acid can be synthesized by the Finkelstein method, where 2,3-difluorobromobenzene is treated with sodium hydride and then boron tribromide. This process yields high selectivity and good yield (up to 85%). The method requires careful handling to maintain high purity and requires the use of anhydrous conditions to prevent hydrolysis. The reaction is typically carried out in dimethylformamide (DMF) solvent.

About

English Name (6-Bromo-2,3-difluorophenyl)boronic acid
Molecular Formula C6H4BBrF2O2
Molecular Weight 236.81 g/mol
SMILES FC1=C(F)C(B(O)O)=C(Br)C=C1
InChIKey VZVDYVBOSRNBQL-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

(6-Bromo-2,3-difluorophenyl)boronic acid is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

(6-Bromo-2,3-difluorophenyl)boronic acid is primarily used in pharmaceuticals and polymer synthesis....

Compound Q&A

What precautions should be taken when handling (6-Bromo-2,3-difluorophenyl)boronic acid (CAS: 870718-10-8)?

When handling (6-Bromo-2,3-difluorophenyl)boronic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...