Compound Q&A

What precautions should be taken when handling (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

Answer

(3,5-Difluoro-4-formylphenyl)boronic acid
When handling (3,5-Difluoro-4-formylphenyl)boronic acid, it is essential to wear appropriate personal protective equipment, such as gloves and safety goggles. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up with caution, and the material safety data sheet (MSDS) should be consulted for detailed spill procedures.

About

English Name (3,5-Difluoro-4-formylphenyl)boronic acid
Molecular Formula C7H5BF2O3
Molecular Weight 185.92 g/mol
SMILES B(c1cc(c(c(c1)F)C=O)F)(O)O
InChIKey XWZOKATWICIEMU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

(3,5-Difluoro-4-formylphenyl)boronic acid is a white crystalline solid with a molecular weight of ap...

Compound Q&A

How is (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9) typically synthesized?

(3,5-Difluoro-4-formylphenyl)boronic acid is usually synthesized through the bromination of 3,5-difl...

Compound Q&A

What industries use (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

(3,5-Difluoro-4-formylphenyl)boronic acid finds applications in the pharmaceutical industry for the ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...