Compound Q&A

What are the physical and chemical properties of (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

Answer

(3,5-Difluoro-4-formylphenyl)boronic acid
(3,5-Difluoro-4-formylphenyl)boronic acid is a white crystalline solid with a molecular weight of approximately 217.10 g/mol. It has a low solubility in water but is more soluble in organic solvents. It is relatively stable under normal conditions but can exhibit reactivity with reducing agents. This compound is commonly used in organic synthesis and as a precatalyst in various reactions.

About

English Name (3,5-Difluoro-4-formylphenyl)boronic acid
Molecular Formula C7H5BF2O3
Molecular Weight 185.92 g/mol
SMILES B(c1cc(c(c(c1)F)C=O)F)(O)O
InChIKey XWZOKATWICIEMU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9) typically synthesized?

(3,5-Difluoro-4-formylphenyl)boronic acid is usually synthesized through the bromination of 3,5-difl...

Compound Q&A

What industries use (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

(3,5-Difluoro-4-formylphenyl)boronic acid finds applications in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

When handling (3,5-Difluoro-4-formylphenyl)boronic acid, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...