Compound Q&A

What industries use (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

Answer

(3,5-Difluoro-4-formylphenyl)boronic acid
(3,5-Difluoro-4-formylphenyl)boronic acid finds applications in the pharmaceutical industry for the synthesis of medicinal compounds, in the semiconductor industry for the fabrication of electronic materials, and in the polymer industry for the development of functional polymers. It is also used in analytical chemistry for sensing applications.

About

English Name (3,5-Difluoro-4-formylphenyl)boronic acid
Molecular Formula C7H5BF2O3
Molecular Weight 185.92 g/mol
SMILES B(c1cc(c(c(c1)F)C=O)F)(O)O
InChIKey XWZOKATWICIEMU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

(3,5-Difluoro-4-formylphenyl)boronic acid is a white crystalline solid with a molecular weight of ap...

Compound Q&A

How is (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9) typically synthesized?

(3,5-Difluoro-4-formylphenyl)boronic acid is usually synthesized through the bromination of 3,5-difl...

Compound Q&A

What precautions should be taken when handling (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

When handling (3,5-Difluoro-4-formylphenyl)boronic acid, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...