Compound Q&A

How is (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9) typically synthesized?

Answer

(3,5-Difluoro-4-formylphenyl)boronic acid
(3,5-Difluoro-4-formylphenyl)boronic acid is usually synthesized through the bromination of 3,5-difluorophenol followed by the addition of boron tribromide and subsequent hydrolysis. This method provides good yield and selectivity. Alternative routes involve the use of other reagents like boronic acids or esters, depending on the desired purity and reactivity of the final product.

About

English Name (3,5-Difluoro-4-formylphenyl)boronic acid
Molecular Formula C7H5BF2O3
Molecular Weight 185.92 g/mol
SMILES B(c1cc(c(c(c1)F)C=O)F)(O)O
InChIKey XWZOKATWICIEMU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

(3,5-Difluoro-4-formylphenyl)boronic acid is a white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

(3,5-Difluoro-4-formylphenyl)boronic acid finds applications in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling (3,5-Difluoro-4-formylphenyl)boronic acid (CAS: 870718-11-9)?

When handling (3,5-Difluoro-4-formylphenyl)boronic acid, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...