Compound Q&A

What industries use Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1)?

Answer

Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate
Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate is used in the pharmaceutical and fine chemical industries for the synthesis of various bioactive molecules. It can also find applications in the development of sensors and materials science, particularly in the field of semiconductors and polymer science.

About

English Name Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate
Molecular Formula C10H9BrN2O2
Molecular Weight 269.1 g/mol
SMILES CCOC(=O)C1=CN=C2N1C=C(C=C2)Br
InChIKey VMTDOHAWLUJHAI-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1)?

Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate is a crystalline compound with a molecular weight ...

Compound Q&A

How is Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1) typically synthesized?

Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate is typically synthesized by the nucleophilic subst...

Compound Q&A

What precautions should be taken when handling Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1)?

When handling Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate, it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...