Compound Q&A

How is Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1) typically synthesized?

Answer

Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate
Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate is typically synthesized by the nucleophilic substitution of ethyl 6-iodimidazo[1,2-a]pyridine-3-carboxylate with bromide ion in the presence of a base such as sodium hydride. The reaction is carried out in a suitable solvent like DMF, leading to a good yield of the target compound with high selectivity.

About

English Name Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate
Molecular Formula C10H9BrN2O2
Molecular Weight 269.1 g/mol
SMILES CCOC(=O)C1=CN=C2N1C=C(C=C2)Br
InChIKey VMTDOHAWLUJHAI-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1)?

Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate is a crystalline compound with a molecular weight ...

Compound Q&A

What industries use Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1)?

Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate is used in the pharmaceutical and fine chemical in...

Compound Q&A

What precautions should be taken when handling Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1)?

When handling Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate, it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...