Compound Q&A

What are the physical and chemical properties of Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1)?

Answer

Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate
Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate is a crystalline compound with a molecular weight of approximately 285.05 g/mol. It has a low solubility in water but is soluble in common organic solvents like DMSO and DMF. This compound is reactive towards nucleophiles and can undergo substitution reactions. It is stable under normal conditions but should be stored in a dry place to avoid hydrolysis.

About

English Name Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate
Molecular Formula C10H9BrN2O2
Molecular Weight 269.1 g/mol
SMILES CCOC(=O)C1=CN=C2N1C=C(C=C2)Br
InChIKey VMTDOHAWLUJHAI-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1) typically synthesized?

Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate is typically synthesized by the nucleophilic subst...

Compound Q&A

What industries use Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1)?

Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate is used in the pharmaceutical and fine chemical in...

Compound Q&A

What precautions should be taken when handling Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS: 372198-69-1)?

When handling Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate, it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...