Compound Q&A

What industries use 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7)?

Answer

2-Fluoro-6-nitro-N-phenylbenzamide
2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry as a precursor for the production of functional polymers, and in sensor technology for developing sensors that can detect specific chemical compounds. Additionally, it is used in some semiconductor applications due to its electronic properties.

About

English Name 2-Fluoro-6-nitro-N-phenylbenzamide
Molecular Formula C13H9FN2O3
Molecular Weight 260.22 g/mol
SMILES O=C(c1c(F)cccc1[N+](=O)[O-])Nc1ccccc1
InChIKey GQVRPSFDUVNMDA-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7)?

2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) is a crystalline solid with a molecular weight...

Compound Q&A

How is 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) typically synthesized?

2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) can be synthesized via a multi-step process, s...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7)?

When handling 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7), it is crucial to follow standar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...