Compound Q&A

How is 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) typically synthesized?

Answer

2-Fluoro-6-nitro-N-phenylbenzamide
2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) can be synthesized via a multi-step process, starting with the nitration of 2-fluorobenzamide. The nitro group is introduced using a mixture of fuming nitric acid and sulfuric acid. Subsequently, the phenyl substituent is introduced via coupling with phenyl isocyanate in the presence of a base like triethylamine. The reaction is typically carried out in an organic solvent such as dichloromethane, with yields ranging from 60-80%.

About

English Name 2-Fluoro-6-nitro-N-phenylbenzamide
Molecular Formula C13H9FN2O3
Molecular Weight 260.22 g/mol
SMILES O=C(c1c(F)cccc1[N+](=O)[O-])Nc1ccccc1
InChIKey GQVRPSFDUVNMDA-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7)?

2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) is a crystalline solid with a molecular weight...

Compound Q&A

What industries use 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7)?

2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7)?

When handling 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7), it is crucial to follow standar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...