Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7)?

Answer

2-Fluoro-6-nitro-N-phenylbenzamide
2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) is a crystalline solid with a molecular weight of approximately 290.13 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. The compound is moderately reactive, particularly with reducing agents, and exhibits weak acidic behavior due to the nitro group. It is stable under normal conditions but should be stored in a dry, cool place to prevent hydrolysis.

About

English Name 2-Fluoro-6-nitro-N-phenylbenzamide
Molecular Formula C13H9FN2O3
Molecular Weight 260.22 g/mol
SMILES O=C(c1c(F)cccc1[N+](=O)[O-])Nc1ccccc1
InChIKey GQVRPSFDUVNMDA-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) typically synthesized?

2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) can be synthesized via a multi-step process, s...

Compound Q&A

What industries use 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7)?

2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7)?

When handling 2-Fluoro-6-nitro-N-phenylbenzamide (CAS: 870281-83-7), it is crucial to follow standar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...