Compound Q&A

What precautions should be taken when handling (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

Answer

(S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine
Proper handling requires the use of personal protective equipment (PPE) such as gloves and safety glasses. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for detailed handling instructions.

About

English Name (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine
Molecular Formula C32H40FeP2
Molecular Weight 552.55 g/mol
SMILES [Fe].C1CCCC1.C[C@H](P(C(C)(C)C)C(C)(C)C)C1CCCC1P(C1=CC=CC=C1)C1=CC=CC=C1
InChIKey KEERMMZARKKVBY-IPMISBIPSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

The compound has a crystalline form and a molecular weight of approximately 601.4 g/mol. It is poorl...

Compound Q&A

How is (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3) typically synthesized?

This compound is synthesized through a multi-step process involving the reaction of di-tert-butylpho...

Compound Q&A

What industries use (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

This compound is primarily used in the pharmaceutical industry for catalytic processes in drug synth...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...