Compound Q&A

What are the physical and chemical properties of (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

Answer

(S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine
The compound has a crystalline form and a molecular weight of approximately 601.4 g/mol. It is poorly soluble in water but soluble in organic solvents like chloroform and THF. Chemically, it is known for its stability in air and its reactivity in coordination chemistry, particularly in catalytic systems.

About

English Name (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine
Molecular Formula C32H40FeP2
Molecular Weight 552.55 g/mol
SMILES [Fe].C1CCCC1.C[C@H](P(C(C)(C)C)C(C)(C)C)C1CCCC1P(C1=CC=CC=C1)C1=CC=CC=C1
InChIKey KEERMMZARKKVBY-IPMISBIPSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3) typically synthesized?

This compound is synthesized through a multi-step process involving the reaction of di-tert-butylpho...

Compound Q&A

What industries use (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

This compound is primarily used in the pharmaceutical industry for catalytic processes in drug synth...

Compound Q&A

What precautions should be taken when handling (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

Proper handling requires the use of personal protective equipment (PPE) such as gloves and safety gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...