Compound Q&A

How is (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3) typically synthesized?

Answer

(S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine
This compound is synthesized through a multi-step process involving the reaction of di-tert-butylphosphine with the corresponding 2-(diphenylphosphino)ferrocene derivative. The synthesis involves careful control of reaction conditions to achieve high yield and selectivity.

About

English Name (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine
Molecular Formula C32H40FeP2
Molecular Weight 552.55 g/mol
SMILES [Fe].C1CCCC1.C[C@H](P(C(C)(C)C)C(C)(C)C)C1CCCC1P(C1=CC=CC=C1)C1=CC=CC=C1
InChIKey KEERMMZARKKVBY-IPMISBIPSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

The compound has a crystalline form and a molecular weight of approximately 601.4 g/mol. It is poorl...

Compound Q&A

What industries use (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

This compound is primarily used in the pharmaceutical industry for catalytic processes in drug synth...

Compound Q&A

What precautions should be taken when handling (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

Proper handling requires the use of personal protective equipment (PPE) such as gloves and safety gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...