Compound Q&A

What industries use (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

Answer

(S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine
This compound is primarily used in the pharmaceutical industry for catalytic processes in drug synthesis. It is also utilized in the polymer industry for the controlled polymerization of monomers and in the semiconductor industry for catalytic applications.

About

English Name (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine
Molecular Formula C32H40FeP2
Molecular Weight 552.55 g/mol
SMILES [Fe].C1CCCC1.C[C@H](P(C(C)(C)C)C(C)(C)C)C1CCCC1P(C1=CC=CC=C1)C1=CC=CC=C1
InChIKey KEERMMZARKKVBY-IPMISBIPSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

The compound has a crystalline form and a molecular weight of approximately 601.4 g/mol. It is poorl...

Compound Q&A

How is (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3) typically synthesized?

This compound is synthesized through a multi-step process involving the reaction of di-tert-butylpho...

Compound Q&A

What precautions should be taken when handling (S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine (CAS: 277306-29-3)?

Proper handling requires the use of personal protective equipment (PPE) such as gloves and safety gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...