Compound Q&A

What precautions should be taken when handling Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

Answer

Latrepirdine Dihydrochloride
When handling Latrepirdine dihydrochloride, use appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Store it in a cool, dry place away from direct sunlight. In case of a spill, use appropriate fume hoods and follow safety data sheet (SDS) guidelines for disposal. Always ensure proper ventilation and follow all safety protocols to avoid inhalation or skin contact.

About

CAS No 97657-92-6
English Name Latrepirdine Dihydrochloride
Molecular Formula C21H27Cl2N3
Molecular Weight 392.37 g/mol
SMILES CC1=CC2=C(C=C1)N(C3=C2CN(CC3)C)CCC4=CN=C(C=C4)C.Cl.Cl
InChIKey GTWLIQOLGOZTLF-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

Latrepirdine dihydrochloride is a crystalline compound with a molecular weight of approximately 454....

Compound Q&A

How is Latrepirdine Dihydrochloride (CAS: 97657-92-6) typically synthesized?

Latrepirdine dihydrochloride is typically synthesized through a multi-step process involving alkylat...

Compound Q&A

What industries use Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

Latrepirdine dihydrochloride is primarily used in the pharmaceutical industry for the development of...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...