Compound Q&A

What industries use Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

Answer

Latrepirdine Dihydrochloride
Latrepirdine dihydrochloride is primarily used in the pharmaceutical industry for the development of therapeutic agents. It is also explored for its potential use in sensors and as a component in some semiconductor materials. Its applications in polymers are limited but show promise in certain specialized areas.

About

CAS No 97657-92-6
English Name Latrepirdine Dihydrochloride
Molecular Formula C21H27Cl2N3
Molecular Weight 392.37 g/mol
SMILES CC1=CC2=C(C=C1)N(C3=C2CN(CC3)C)CCC4=CN=C(C=C4)C.Cl.Cl
InChIKey GTWLIQOLGOZTLF-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

Latrepirdine dihydrochloride is a crystalline compound with a molecular weight of approximately 454....

Compound Q&A

How is Latrepirdine Dihydrochloride (CAS: 97657-92-6) typically synthesized?

Latrepirdine dihydrochloride is typically synthesized through a multi-step process involving alkylat...

Compound Q&A

What precautions should be taken when handling Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

When handling Latrepirdine dihydrochloride, use appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...