Compound Q&A

How is Latrepirdine Dihydrochloride (CAS: 97657-92-6) typically synthesized?

Answer

Latrepirdine Dihydrochloride
Latrepirdine dihydrochloride is typically synthesized through a multi-step process involving alkylation, cyclization, and hydrochloridation reactions. Common catalysts include sulfuric acid and palladium complexes. The reaction is selective and yields high purity products, making it suitable for pharmaceutical production.

About

CAS No 97657-92-6
English Name Latrepirdine Dihydrochloride
Molecular Formula C21H27Cl2N3
Molecular Weight 392.37 g/mol
SMILES CC1=CC2=C(C=C1)N(C3=C2CN(CC3)C)CCC4=CN=C(C=C4)C.Cl.Cl
InChIKey GTWLIQOLGOZTLF-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

Latrepirdine dihydrochloride is a crystalline compound with a molecular weight of approximately 454....

Compound Q&A

What industries use Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

Latrepirdine dihydrochloride is primarily used in the pharmaceutical industry for the development of...

Compound Q&A

What precautions should be taken when handling Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

When handling Latrepirdine dihydrochloride, use appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...