Compound Q&A

What are the physical and chemical properties of Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

Answer

Latrepirdine Dihydrochloride
Latrepirdine dihydrochloride is a crystalline compound with a molecular weight of approximately 454.7 g/mol. It is soluble in water and ethanol. This compound has moderate reactivity, especially in basic conditions, and should be handled with care to avoid unwanted reactions. Its stability in various solvents and pH conditions makes it suitable for pharmaceutical applications.

About

CAS No 97657-92-6
English Name Latrepirdine Dihydrochloride
Molecular Formula C21H27Cl2N3
Molecular Weight 392.37 g/mol
SMILES CC1=CC2=C(C=C1)N(C3=C2CN(CC3)C)CCC4=CN=C(C=C4)C.Cl.Cl
InChIKey GTWLIQOLGOZTLF-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is Latrepirdine Dihydrochloride (CAS: 97657-92-6) typically synthesized?

Latrepirdine dihydrochloride is typically synthesized through a multi-step process involving alkylat...

Compound Q&A

What industries use Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

Latrepirdine dihydrochloride is primarily used in the pharmaceutical industry for the development of...

Compound Q&A

What precautions should be taken when handling Latrepirdine Dihydrochloride (CAS: 97657-92-6)?

When handling Latrepirdine dihydrochloride, use appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...