Compound Q&A

What precautions should be taken when handling 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

Answer

6-Bromo-2-nitro-3-pyridinol
When handling 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9), it is crucial to use proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to avoid inhalation. Spills should be handled carefully, and the material safety data sheet (MSDS) should be referenced for detailed emergency procedures.

About

English Name 6-Bromo-2-nitro-3-pyridinol
Molecular Formula C5H3BrN2O3
Molecular Weight 218.99 g/mol
SMILES C1=CC(=NC(=C1O)[N+](=O)[O-])Br
InChIKey GSGNTVQLHGOEMB-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) typically synthesized?

6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) is typically synthesized via the nitration of 6-bromo...

Compound Q&A

What industries use 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) finds applications in the pharmaceutical industry, pa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...