Compound Q&A

How is 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) typically synthesized?

Answer

6-Bromo-2-nitro-3-pyridinol
6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) is typically synthesized via the nitration of 6-bromo-3-pyridinol followed by reduction of the nitro group. Common methods include the use of concentrated nitric acid and sulfuric acid as the nitration reagent, and subsequent reduction with sodium borohydride or other mild reducing agents.

About

English Name 6-Bromo-2-nitro-3-pyridinol
Molecular Formula C5H3BrN2O3
Molecular Weight 218.99 g/mol
SMILES C1=CC(=NC(=C1O)[N+](=O)[O-])Br
InChIKey GSGNTVQLHGOEMB-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) finds applications in the pharmaceutical industry, pa...

Compound Q&A

What precautions should be taken when handling 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

When handling 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9), it is crucial to use proper personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...