Compound Q&A

What industries use 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

Answer

6-Bromo-2-nitro-3-pyridinol
6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) finds applications in the pharmaceutical industry, particularly in the synthesis of certain drugs and intermediates. It is also used in the polymer industry for the development of new materials and in the sensor industry for the fabrication of gas-sensitive devices.

About

English Name 6-Bromo-2-nitro-3-pyridinol
Molecular Formula C5H3BrN2O3
Molecular Weight 218.99 g/mol
SMILES C1=CC(=NC(=C1O)[N+](=O)[O-])Br
InChIKey GSGNTVQLHGOEMB-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) typically synthesized?

6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) is typically synthesized via the nitration of 6-bromo...

Compound Q&A

What precautions should be taken when handling 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

When handling 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9), it is crucial to use proper personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...