Compound Q&A

What are the physical and chemical properties of 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

Answer

6-Bromo-2-nitro-3-pyridinol
6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) is a crystalline solid with a molecular weight of approximately 217.03 g/mol. It is slightly soluble in water and has a pKa of about 6.5. Chemically, it is highly reactive, particularly towards nucleophilic substitution reactions at the bromine substituent and nitro group.

About

English Name 6-Bromo-2-nitro-3-pyridinol
Molecular Formula C5H3BrN2O3
Molecular Weight 218.99 g/mol
SMILES C1=CC(=NC(=C1O)[N+](=O)[O-])Br
InChIKey GSGNTVQLHGOEMB-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) typically synthesized?

6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) is typically synthesized via the nitration of 6-bromo...

Compound Q&A

What industries use 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9) finds applications in the pharmaceutical industry, pa...

Compound Q&A

What precautions should be taken when handling 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9)?

When handling 6-Bromo-2-nitro-3-pyridinol (CAS: 443956-08-9), it is crucial to use proper personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...