Compound Q&A

What precautions should be taken when handling 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

Answer

3,5-Dichloro-2-pyrazinecarboxylic acid
When handling 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5), it is recommended to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a closed container at room temperature and away from direct sunlight. In case of a spill, the area should be ventilated, and appropriate containment measures should be taken to prevent environmental contamination. For further safety information, refer to the Material Safety Data Sheet (MSDS).

About

English Name 3,5-Dichloro-2-pyrazinecarboxylic acid
Molecular Formula C5H2Cl2N2O2
Molecular Weight 192.99 g/mol
SMILES C1=C(N=C(C(=N1)C(=O)O)Cl)Cl
InChIKey QRFOSHOPPFYNAH-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is a crystalline white solid with a molecu...

Compound Q&A

How is 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) typically synthesized?

3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is typically synthesized via the condensat...

Compound Q&A

What industries use 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is primarily used in the pharmaceutical in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...