Compound Q&A

How is 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) typically synthesized?

Answer

3,5-Dichloro-2-pyrazinecarboxylic acid
3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is typically synthesized via the condensation of 2-chloro-pyrazine with chloroacetyl chloride in the presence of a catalyst like sodium carbonate. The yield is usually around 70-75%, and the reaction is performed under mild conditions to ensure high selectivity and purity.

About

English Name 3,5-Dichloro-2-pyrazinecarboxylic acid
Molecular Formula C5H2Cl2N2O2
Molecular Weight 192.99 g/mol
SMILES C1=C(N=C(C(=N1)C(=O)O)Cl)Cl
InChIKey QRFOSHOPPFYNAH-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is a crystalline white solid with a molecu...

Compound Q&A

What industries use 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

When handling 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5), it is recommended to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...