Compound Q&A

What are the physical and chemical properties of 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

Answer

3,5-Dichloro-2-pyrazinecarboxylic acid
3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is a crystalline white solid with a molecular weight of approximately 213.04 g/mol. It has a melting point of about 185-186°C and a pKa of around 4.2. The compound is slightly soluble in water but soluble in common organic solvents like methanol and acetonitrile. It shows moderate reactivity towards nucleophiles and can be used as a starting material in various organic synthesis reactions.

About

English Name 3,5-Dichloro-2-pyrazinecarboxylic acid
Molecular Formula C5H2Cl2N2O2
Molecular Weight 192.99 g/mol
SMILES C1=C(N=C(C(=N1)C(=O)O)Cl)Cl
InChIKey QRFOSHOPPFYNAH-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

How is 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) typically synthesized?

3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is typically synthesized via the condensat...

Compound Q&A

What industries use 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

When handling 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5), it is recommended to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...