Compound Q&A

What industries use 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

Answer

3,5-Dichloro-2-pyrazinecarboxylic acid
3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also utilized in the polymer industry for the production of specialized polymers. Additionally, it has applications in the development of sensors and semiconductors, particularly in the electronics sector.

About

English Name 3,5-Dichloro-2-pyrazinecarboxylic acid
Molecular Formula C5H2Cl2N2O2
Molecular Weight 192.99 g/mol
SMILES C1=C(N=C(C(=N1)C(=O)O)Cl)Cl
InChIKey QRFOSHOPPFYNAH-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is a crystalline white solid with a molecu...

Compound Q&A

How is 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) typically synthesized?

3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5) is typically synthesized via the condensat...

Compound Q&A

What precautions should be taken when handling 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5)?

When handling 3,5-Dichloro-2-pyrazinecarboxylic acid (CAS: 312736-49-5), it is recommended to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...