Compound Q&A

What precautions should be taken when handling [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

Answer

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid
PPE such as gloves and goggles should be worn when handling [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid. It should be stored in a fume hood to minimize exposure. In case of a spill, it should be carefully cleaned up using appropriate absorbents. Emergency showers and eye wash stations should be available. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid
Molecular Formula C7H8BNO4
Molecular Weight 180.96 g/mol
SMILES B(C1=CC(=CN=C1)C(=O)OC)(O)O
InChIKey PGTWAVVFCNTGCS-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid is a crystalline solid with a molecular weight of appr...

Compound Q&A

How is [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2) typically synthesized?

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid is commonly synthesized via a multistep process involv...

Compound Q&A

What industries use [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid finds applications in pharmaceuticals, where it serves...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...