Compound Q&A

What industries use [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

Answer

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid
[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid finds applications in pharmaceuticals, where it serves as a building block for drug synthesis, and in polymer science, where it is used as a monomer or crosslinker. It is also used in sensor technology for detecting various analytes and in semiconductor manufacturing for etching and other processes.

About

English Name [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid
Molecular Formula C7H8BNO4
Molecular Weight 180.96 g/mol
SMILES B(C1=CC(=CN=C1)C(=O)OC)(O)O
InChIKey PGTWAVVFCNTGCS-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid is a crystalline solid with a molecular weight of appr...

Compound Q&A

How is [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2) typically synthesized?

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid is commonly synthesized via a multistep process involv...

Compound Q&A

What precautions should be taken when handling [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

PPE such as gloves and goggles should be worn when handling [5-(Methoxycarbonyl)-3-pyridinyl]boronic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...