Compound Q&A

How is [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2) typically synthesized?

Answer

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid
[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid is commonly synthesized via a multistep process involving the protection of the pyridine ring, followed by the introduction of the methoxycarbonyl group, and finally the formation of the boronic acid moiety. This process often uses reagents such as methoxycarbonyl chloride, boronic acids, and palladium catalysts. The overall yield can vary, but efficient methods can achieve up to 85% yield.

About

English Name [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid
Molecular Formula C7H8BNO4
Molecular Weight 180.96 g/mol
SMILES B(C1=CC(=CN=C1)C(=O)OC)(O)O
InChIKey PGTWAVVFCNTGCS-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid is a crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid finds applications in pharmaceuticals, where it serves...

Compound Q&A

What precautions should be taken when handling [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

PPE such as gloves and goggles should be worn when handling [5-(Methoxycarbonyl)-3-pyridinyl]boronic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...