Compound Q&A

What are the physical and chemical properties of [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

Answer

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid
[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid is a crystalline solid with a molecular weight of approximately 258.26 g/mol. It is sparingly soluble in water and organic solvents. Chemically, it is reactive towards bases and may undergo deprotection or other transformations under certain conditions. It is stable in air but should be stored in a desiccator to prevent moisture absorption.

About

English Name [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid
Molecular Formula C7H8BNO4
Molecular Weight 180.96 g/mol
SMILES B(C1=CC(=CN=C1)C(=O)OC)(O)O
InChIKey PGTWAVVFCNTGCS-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2) typically synthesized?

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid is commonly synthesized via a multistep process involv...

Compound Q&A

What industries use [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

[5-(Methoxycarbonyl)-3-pyridinyl]boronic acid finds applications in pharmaceuticals, where it serves...

Compound Q&A

What precautions should be taken when handling [5-(Methoxycarbonyl)-3-pyridinyl]boronic acid (CAS: 871329-53-2)?

PPE such as gloves and goggles should be worn when handling [5-(Methoxycarbonyl)-3-pyridinyl]boronic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...