Compound Q&A

What industries use 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0)?

Answer

2-Bromo-3-methyl-5-nitropyridine
2-Bromo-3-methyl-5-nitropyridine is primarily used in the pharmaceutical industry for the synthesis of drug intermediates. It also finds applications in the production of sensors and as a precursor in the development of new materials. Additionally, it is used in the semiconductor industry for specific chemical processes.

About

CAS No 23132-21-0
English Name 2-Bromo-3-methyl-5-nitropyridine
Molecular Formula C6H5BrN2O2
Molecular Weight 217.02 g/mol
SMILES CC1=CC(=CN=C1Br)[N+](=O)[O-]
InChIKey FZIQHPKXSLHGBZ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0)?

2-Bromo-3-methyl-5-nitropyridine is a crystalline solid with a molecular weight of approximately 223...

Compound Q&A

How is 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0) typically synthesized?

2-Bromo-3-methyl-5-nitropyridine is typically synthesized via the nitration of 3-methyl-2-pyridinebo...

Compound Q&A

What precautions should be taken when handling 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0)?

Handling 2-Bromo-3-methyl-5-nitropyridine requires strict safety measures due to its reactivity. Alw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...